CAS 20262-55-9 appears in our catalog under these names: 4-Carboxyphthalimide, 97%, 1,3-Dioxoisoindoline-5-carboxylic acid, 97%, 1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic a acid, 1,3-Dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 5g, on request, 0,5g, 250mg.
1,3-dioxoisoindole-5-carboxylic acid (CAS 20262-55-9) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 1,3-dioxoisoindole-5-carboxylic acid. InChIKey: ARRQNZZBVOIEQQ-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | ARRQNZZBVOIEQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)NC2=O |
Computed by PubChem (NCBI)