Products 30145-92-7
CAS 30145-92-7 is the registry number for 4-Oxo-4H-pyrano[3,2-b]pyridine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxopyrano[3,2-b]pyridine-2-carboxylic acid (CAS 30145-92-7) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 4-oxopyrano[3,2-b]pyridine-2-carboxylic acid. InChIKey: QVTZCBJCAONEOI-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 4-oxopyrano[3,2-b]pyridine-2-carboxylic acid |
| InChIKey | QVTZCBJCAONEOI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C=C(O2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)