CAS 120517-48-8 is the registry number for 4-Ethynylpyridine-2,6-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynylpyridine-2,6-dicarboxylic acid (CAS 120517-48-8) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 4-ethynylpyridine-2,6-dicarboxylic acid. InChIKey: TUICWVDBXCDYBT-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 4-ethynylpyridine-2,6-dicarboxylic acid |
| InChIKey | TUICWVDBXCDYBT-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=NC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)