Products 120517-48-8

CAS 120517-48-8 is the registry number for 4-Ethynylpyridine-2,6-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-ethynylpyridine-2,6-dicarboxylic acid (CAS 120517-48-8) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 4-ethynylpyridine-2,6-dicarboxylic acid. InChIKey: TUICWVDBXCDYBT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5NO4
Molecular weight191.14 g/mol
IUPAC name4-ethynylpyridine-2,6-dicarboxylic acid
InChIKeyTUICWVDBXCDYBT-UHFFFAOYSA-N
SMILESC#CC1=CC(=NC(=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)