CAS 2725-81-7 appears in our catalog under these names: 6-Nitrocoumarin, 95%, 6–Nitrocoumarin, 6-Nitrocoumarin, 98+% , 6-Nitrocoumarin, >98.0%(GC), 6-Nitrocoumarin. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g, 500g, 250mg.
6-nitrochromen-2-one (CAS 2725-81-7) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 6-nitrochromen-2-one. InChIKey: RMERXEXZXIVNBF-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 6-nitrochromen-2-one |
| InChIKey | RMERXEXZXIVNBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)