2,3-Diphenylquinoxaline, 98%
cas: 1684-14-6 — see every product listed under this CAS number, including other names
2,3-Diphenylquinoxaline, 98% (CAS 1684-14-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A137268-5g |
| cas | 1684-14-6 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 665.19 Pln | |
| Ambeed | 500g | 2089.19 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 390.80 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 225.50 Pln | |
| BLDpharm | 100g | 636.47 Pln | |
| BLDpharm | 500g | 2041.53 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 102.06 Pln | |
| Fluorochem | 100g | 643.54 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,3-diphenylquinoxaline (CAS 1684-14-6) is a chemical compound with the molecular formula C20H14N2 and a molecular weight of 282.3 g/mol. IUPAC name: 2,3-diphenylquinoxaline. InChIKey: RSNQVABHABAKEZ-UHFFFAOYSA-N.
| Molecular formula | C20H14N2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 2,3-diphenylquinoxaline |
| InChIKey | RSNQVABHABAKEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)