CAS 1373281-73-2 is the registry number for 5-Phenyl-5,10-dihydroindolo[3,2-b]indole 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
10-phenyl-5H-indolo[3,2-b]indole (CAS 1373281-73-2) is a chemical compound with the molecular formula C20H14N2 and a molecular weight of 282.3 g/mol. IUPAC name: 10-phenyl-5H-indolo[3,2-b]indole. InChIKey: STNNPBPKUZWTIE-UHFFFAOYSA-N.
| Molecular formula | C20H14N2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 10-phenyl-5H-indolo[3,2-b]indole |
| InChIKey | STNNPBPKUZWTIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C4=C2C5=CC=CC=C5N4 |
Computed by PubChem (NCBI)