CAS 950520-39-5 appears in our catalog under these names: 2,6–Di(pyridin–4–yl)naphthalene, 2,6-Di(pyridin-4-yl)naphthalene 95%, 2,6-Di(pyridin-4-yl)naphthalene, 98%, 98%, 2,6-Di(pyridin-4-yl)naphthalene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-(6-pyridin-4-ylnaphthalen-2-yl)pyridine (CAS 950520-39-5) is a chemical compound with the molecular formula C20H14N2 and a molecular weight of 282.3 g/mol. IUPAC name: 4-(6-pyridin-4-ylnaphthalen-2-yl)pyridine. InChIKey: LJFCQYVWDOGEPV-UHFFFAOYSA-N.
| Molecular formula | C20H14N2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 4-(6-pyridin-4-ylnaphthalen-2-yl)pyridine |
| InChIKey | LJFCQYVWDOGEPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=CC=NC=C3)C=C1C4=CC=NC=C4 |
Computed by PubChem (NCBI)