CAS 1684-14-6 appears in our catalog under these names: 2,3–Diphenylquinoxaline, 2,3-Diphenylquinoxaline, 98+% , 2,3-Diphenylquinoxaline, 2,3-Diphenylquinoxaline 98%, 2,3-Diphenylquinoxaline, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 50g, 250g, 500g, 1g, 10g.
2,3-diphenylquinoxaline (CAS 1684-14-6) is a chemical compound with the molecular formula C20H14N2 and a molecular weight of 282.3 g/mol. IUPAC name: 2,3-diphenylquinoxaline. InChIKey: RSNQVABHABAKEZ-UHFFFAOYSA-N.
| Molecular formula | C20H14N2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 2,3-diphenylquinoxaline |
| InChIKey | RSNQVABHABAKEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)