CAS 1429342-63-1 appears in our catalog under these names: 1,4–Di(pyridin–4–yl)naphthalene, 1,4-Di(pyridin-4-yl)naphthalene 98%, 1,4-Di(pyridin-4-yl)naphthalene, 97%, 97%, 1,4-Di(pyridin-4-yl)naphthalene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-(4-pyridin-4-ylnaphthalen-1-yl)pyridine (CAS 1429342-63-1) is a chemical compound with the molecular formula C20H14N2 and a molecular weight of 282.3 g/mol. IUPAC name: 4-(4-pyridin-4-ylnaphthalen-1-yl)pyridine. InChIKey: MRHFNULMVZGXSQ-UHFFFAOYSA-N.
| Molecular formula | C20H14N2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 4-(4-pyridin-4-ylnaphthalen-1-yl)pyridine |
| InChIKey | MRHFNULMVZGXSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=CC=NC=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)