CAS 487-10-5 appears in our catalog under these names: 1,1'-Azonaphthalene, min. 95 %, 10 g, 1,1'-Azonaphthalene, min. 95 %, 5 g, 1,1'-Azonaphthalene, 95%, 1,1'-Azonaphthalene, min. 95 %, 25 g. Offered by: Roth, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
Dinaphthalen-1-yldiazene (CAS 487-10-5) is a chemical compound with the molecular formula C20H14N2 and a molecular weight of 282.3 g/mol. IUPAC name: dinaphthalen-1-yldiazene. InChIKey: ICIDZHMCYAIUIJ-UHFFFAOYSA-N.
| Molecular formula | C20H14N2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | dinaphthalen-1-yldiazene |
| InChIKey | ICIDZHMCYAIUIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N=NC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)