cas: 1936385-56-6 — see every product listed under this CAS number, including other names
2,3-dichloro-6-methyl-5-nitropyridine, 95% (CAS 1936385-56-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg, 2.5g, 5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HD-2198-1g |
| cas | 1936385-56-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 1013.20 Pln | |
| Fluorochem | 250mg | 1830.62 Pln | |
| Fluorochem | 500mg | 3101.01 Pln | |
| Fluorochem | 1g | 3965.29 Pln | |
| Fluorochem | 2.5g | 7703.56 Pln | |
| Fluorochem | 5g | 11384.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,3-dichloro-6-methyl-5-nitropyridine (CAS 1936385-56-6) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,3-dichloro-6-methyl-5-nitropyridine. InChIKey: YLSJKTLFQQKWJM-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,3-dichloro-6-methyl-5-nitropyridine |
| InChIKey | YLSJKTLFQQKWJM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)