cas: 83797-69-7 — see every product listed under this CAS number, including other names
2,4(1H,3H)-PYRIMIDINEDIONE, 6-(OCTYLAMINO)-, 99% (CAS 83797-69-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F500315-25MG |
| cas | 83797-69-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 3944.46 Pln | |
| Fluorochem | 100mg | 12170.73 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
6-(octylamino)-1H-pyrimidine-2,4-dione (CAS 83797-69-7) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: 6-(octylamino)-1H-pyrimidine-2,4-dione. InChIKey: PFSWASUQURIOOR-UHFFFAOYSA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 6-(octylamino)-1H-pyrimidine-2,4-dione |
| InChIKey | PFSWASUQURIOOR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNC1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)