cas: 83797-69-7 — see every product listed under this CAS number, including other names
6-OAU (CAS 83797-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: TargetMol, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T2036-1mg |
| cas | 83797-69-7 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 1222.97 Pln | |
| TargetMol | 2mg | 1620.98 Pln | |
| TargetMol | 5mg | 2385.13 Pln | |
| TargetMol | 10mg | 3334.31 Pln | |
| TargetMol | 25mg | 5200.81 Pln | |
| TargetMol | 50mg | 7325.57 Pln | |
| TargetMol | 100mg | 9789.65 Pln | |
| Biosynth | 50mg | price on request | |
| Biosynth | 25mg | price on request | |
| Biosynth | 100mg | price on request | |
| Biosynth | 500mg | price on request | |
| Biosynth | 250mg | price on request |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
6-(octylamino)-1H-pyrimidine-2,4-dione (CAS 83797-69-7) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: 6-(octylamino)-1H-pyrimidine-2,4-dione. InChIKey: PFSWASUQURIOOR-UHFFFAOYSA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 6-(octylamino)-1H-pyrimidine-2,4-dione |
| InChIKey | PFSWASUQURIOOR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNC1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)