cas: 83797-69-7 — see every product listed under this CAS number, including other names
6-OAU, 99.77% (CAS 83797-69-7) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 100 mg, 10 mg, 10mM/1mL, 25 mg, 1 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-12764-50 mg |
| cas | 83797-69-7 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 6598.38 Pln | |
| MedChemExpress | 100 mg | 8757.84 Pln | |
| MedChemExpress | 10 mg | 2999.28 Pln | |
| MedChemExpress | 10mM/1mL | 2641.69 Pln | |
| MedChemExpress | 25 mg | 4675.76 Pln | |
| MedChemExpress | 1 mg | 1081.31 Pln | |
| MedChemExpress | 5 mg | 2135.50 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.77% |
6-(octylamino)-1H-pyrimidine-2,4-dione (CAS 83797-69-7) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: 6-(octylamino)-1H-pyrimidine-2,4-dione. InChIKey: PFSWASUQURIOOR-UHFFFAOYSA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 6-(octylamino)-1H-pyrimidine-2,4-dione |
| InChIKey | PFSWASUQURIOOR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNC1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)