cas: 83797-69-7 — see every product listed under this CAS number, including other names
6-OAU, 98%, 98% (CAS 83797-69-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4QR-5mg |
| cas | 83797-69-7 |
| size | 5mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 616.40 Pln | |
| Chemat | 25mg | 1984.40 Pln | |
| Chemat | 100mg | 6069.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(octylamino)-1H-pyrimidine-2,4-dione (CAS 83797-69-7) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: 6-(octylamino)-1H-pyrimidine-2,4-dione. InChIKey: PFSWASUQURIOOR-UHFFFAOYSA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 6-(octylamino)-1H-pyrimidine-2,4-dione |
| InChIKey | PFSWASUQURIOOR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNC1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)