cas: 1470-79-7 — see every product listed under this CAS number, including other names
2,4,4'-Trihydroxybenzophenone, >98.0%(HPLC)(T) (CAS 1470-79-7) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0584-10G |
| cas | 1470-79-7 |
| size | 10g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10g | 570.73 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone (CAS 1470-79-7) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: OKJFKPFBSPZTAH-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)