cas: 1470-79-7 — see every product listed under this CAS number, including other names
2,4,4-Trihydroxybenzophenone, 98%, 98% (CAS 1470-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112EI7-250mg |
| cas | 1470-79-7 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 10g | 338.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone (CAS 1470-79-7) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: OKJFKPFBSPZTAH-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)