cas: 1470-79-7 — see every product listed under this CAS number, including other names
2,4,4-Trihydroxybenzophenone 98% (CAS 1470-79-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A902031-1g |
| cas | 1470-79-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1026.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A902031 |
(2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone (CAS 1470-79-7) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: OKJFKPFBSPZTAH-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)