cas: 112811-63-9 — see every product listed under this CAS number, including other names
2,4,5-Trifluoro-3-methoxybenzonitrile 98% (CAS 112811-63-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A347251-1g |
| cas | 112811-63-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 542.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A347251 |
2,4,5-trifluoro-3-methoxybenzonitrile (CAS 112811-63-9) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzonitrile. InChIKey: JFKKSZAQWUIHBF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzonitrile |
| InChIKey | JFKKSZAQWUIHBF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C#N)F |
Computed by PubChem (NCBI)