CAS 1548-13-6 appears in our catalog under these names: 4–(Trifluoromethyl)phenyl isocyanate, 4-(Trifluoromethyl)phenyl isocyanate, 98% , 4-(Trifluoromethyl)phenyl Isocyanate, >98.0%(GC), 4-(Trifluoromethyl)phenylisocyanate 99%, ALPHA,ALPHA,ALPHA-TRIFLUORO-P-TOLYL ISOC. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 1g, 5g.
1-isocyanato-4-(trifluoromethyl)benzene (CAS 1548-13-6) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 1-isocyanato-4-(trifluoromethyl)benzene. InChIKey: QZTWVDCKDWZCLV-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 1-isocyanato-4-(trifluoromethyl)benzene |
| InChIKey | QZTWVDCKDWZCLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N=C=O |
Computed by PubChem (NCBI)