CAS 112811-63-9 appears in our catalog under these names: 3-Methoxy-2,4,5-trifluorobenzonitrile, 98%, 2,4,5-Trifluoro-3-methoxybenzonitrile 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 25g.
2,4,5-trifluoro-3-methoxybenzonitrile (CAS 112811-63-9) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzonitrile. InChIKey: JFKKSZAQWUIHBF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzonitrile |
| InChIKey | JFKKSZAQWUIHBF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C#N)F |
Computed by PubChem (NCBI)