CAS 1184746-15-3 is the registry number for 1,2,4-Trifluoro-5-(isocyanatomethyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,4-trifluoro-5-(isocyanatomethyl)benzene (CAS 1184746-15-3) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 1,2,4-trifluoro-5-(isocyanatomethyl)benzene. InChIKey: KJSYORNIGFOSLN-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 1,2,4-trifluoro-5-(isocyanatomethyl)benzene |
| InChIKey | KJSYORNIGFOSLN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)CN=C=O |
Computed by PubChem (NCBI)