Products 1017779-49-5
CAS 1017779-49-5 is the registry number for 4-(Difluoromethoxy)-2-fluorobenzonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 100mg.
4-(difluoromethoxy)-2-fluorobenzonitrile (CAS 1017779-49-5) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 4-(difluoromethoxy)-2-fluorobenzonitrile. InChIKey: OERIHGQAGTVWPN-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 4-(difluoromethoxy)-2-fluorobenzonitrile |
| InChIKey | OERIHGQAGTVWPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)F)F)C#N |
Computed by PubChem (NCBI)