CAS 2285-12-3 appears in our catalog under these names: 2-(Trifluoromethyl)phenyl isocyanate, 97% , 2-(Trifluoromethyl)phenyl Isocyanate, >98.0%(GC), 2-(Trifluoromethyl)phenylisocyanate 95%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
1-isocyanato-2-(trifluoromethyl)benzene (CAS 2285-12-3) is a chemical compound with the molecular formula C8H4F3NO and a molecular weight of 187.12 g/mol. IUPAC name: 1-isocyanato-2-(trifluoromethyl)benzene. InChIKey: GZWGTVZRRFPVAS-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 1-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | GZWGTVZRRFPVAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N=C=O |
Computed by PubChem (NCBI)