cas: 938-18-1 — see every product listed under this CAS number, including other names
2,4,6-Trimethylbenzoyl Chloride, >98.0%(GC)(T) (CAS 938-18-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2470-25G |
| cas | 938-18-1 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 267.35 Pln | |
| TCI | 100g | 532.88 Pln | |
| TCI | 500g | 1452.41 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,4,6-trimethylbenzoyl chloride (CAS 938-18-1) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2,4,6-trimethylbenzoyl chloride. InChIKey: UKRQMDIFLKHCRO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2,4,6-trimethylbenzoyl chloride |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)Cl)C |
Computed by PubChem (NCBI)