cas: 938-18-1 — see every product listed under this CAS number, including other names
2,4,6-Trimethylbenzoyl chloride, 98% (CAS 938-18-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 244280100 |
| cas | 938-18-1 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 332.30 Pln | |
| Thermo Scientific (Acros) | 50g | 1189.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
2,4,6-trimethylbenzoyl chloride (CAS 938-18-1) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2,4,6-trimethylbenzoyl chloride. InChIKey: UKRQMDIFLKHCRO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2,4,6-trimethylbenzoyl chloride |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)Cl)C |
Computed by PubChem (NCBI)