cas: 938-18-1 — see every product listed under this CAS number, including other names
2,4,6-Trimethylbenzoyl chloride, 97% (CAS 938-18-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 1G. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-4307-100g |
| cas | 938-18-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1kg | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Sigma-Aldrich | 1G | 410.00 Pln | |
| Sigma-Aldrich | 5G | 1240.00 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 100g | 362.39 Pln | |
| Fluorochem | 500g | 909.07 Pln | |
| Fluorochem | 1kg | 1580.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4,6-trimethylbenzoyl chloride (CAS 938-18-1) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2,4,6-trimethylbenzoyl chloride. InChIKey: UKRQMDIFLKHCRO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2,4,6-trimethylbenzoyl chloride |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)Cl)C |
Computed by PubChem (NCBI)