cas: 1205748-61-3 — see every product listed under this CAS number, including other names
2,4-Di([1,1'-biphenyl]-3-yl)-6-chloro-1,3,5-triazine, 97% (CAS 1205748-61-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F864188-250MG |
| cas | 1205748-61-3 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1231.88 Pln | |
| Fluorochem | 10g | 1830.62 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 10g | 1096.40 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine (CAS 1205748-61-3) is a chemical compound with the molecular formula C27H18ClN3 and a molecular weight of 419.9 g/mol. IUPAC name: 2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine. InChIKey: SVNMSEVGOAHNKQ-UHFFFAOYSA-N.
| Molecular formula | C27H18ClN3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| InChIKey | SVNMSEVGOAHNKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=NC(=NC(=N3)Cl)C4=CC=CC(=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)