CAS 1205748-61-3 appears in our catalog under these names: 2,4-Di((1,1'-biphenyl)-3-yl)-6-chloro-1,3,5-triazine, 97%, 2,4–Di((1,1'–biphenyl)–3–yl)–6–chloro–1,3,5–triaz–ine, 2,4-Di([1,1'-biphenyl]-3-yl)-6-chloro-1,3,5-triazine, 97%, 97%, 2,4-Di([1,1'-biphenyl]-3-yl)-6-chloro-1,3,5-triazine, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine (CAS 1205748-61-3) is a chemical compound with the molecular formula C27H18ClN3 and a molecular weight of 419.9 g/mol. IUPAC name: 2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine. InChIKey: SVNMSEVGOAHNKQ-UHFFFAOYSA-N.
| Molecular formula | C27H18ClN3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| InChIKey | SVNMSEVGOAHNKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=NC(=NC(=N3)Cl)C4=CC=CC(=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)