Products 1518823-36-3
CAS 1518823-36-3 is the registry number for 2-(5-Chloro-[1,1'-biphenyl]-3-yl)-4,6-diphenyl-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
2-(3-chloro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine (CAS 1518823-36-3) is a chemical compound with the molecular formula C27H18ClN3 and a molecular weight of 419.9 g/mol. IUPAC name: 2-(3-chloro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: QFCRVMSYTZGFBB-UHFFFAOYSA-N.
| Molecular formula | C27H18ClN3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-(3-chloro-5-phenylphenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | QFCRVMSYTZGFBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)C3=NC(=NC(=N3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)