CAS 1814942-40-9 is the registry number for 2,4-Bis([1,1'-biphenyl]-2-yl)-6-chloro-1,3,5-triazine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4,6-bis(2-phenylphenyl)-1,3,5-triazine (CAS 1814942-40-9) is a chemical compound with the molecular formula C27H18ClN3 and a molecular weight of 419.9 g/mol. IUPAC name: 2-chloro-4,6-bis(2-phenylphenyl)-1,3,5-triazine. InChIKey: BQAAOLCSBWKLSQ-UHFFFAOYSA-N.
| Molecular formula | C27H18ClN3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-chloro-4,6-bis(2-phenylphenyl)-1,3,5-triazine |
| InChIKey | BQAAOLCSBWKLSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=NC(=NC(=N3)Cl)C4=CC=CC=C4C5=CC=CC=C5 |
Computed by PubChem (NCBI)