CAS 1443049-86-2 appears in our catalog under these names: 2-(4'-Chloro-[1,1'-biphenyl]-4-yl)-4,6-diphenyl-1,3,5-triazine, 95%, 2-(4'-Chloro-[1,1'-biphenyl]-4-yl)-4,6-diphenyl-1,3,5-triazine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100g.
2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine (CAS 1443049-86-2) is a chemical compound with the molecular formula C27H18ClN3 and a molecular weight of 419.9 g/mol. IUPAC name: 2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine. InChIKey: RREZXVNHMVSZGG-UHFFFAOYSA-N.
| Molecular formula | C27H18ClN3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-[4-(4-chlorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| InChIKey | RREZXVNHMVSZGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)C4=CC=C(C=C4)Cl)C5=CC=CC=C5 |
Computed by PubChem (NCBI)