CAS 2279137-61-8 is the registry number for 2-([1,1'-Biphenyl]-2-yl)-4-([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine (CAS 2279137-61-8) is a chemical compound with the molecular formula C27H18ClN3 and a molecular weight of 419.9 g/mol. IUPAC name: 2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine. InChIKey: JTIDSLLLZDWOHA-UHFFFAOYSA-N.
| Molecular formula | C27H18ClN3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-chloro-4-(2-phenylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| InChIKey | JTIDSLLLZDWOHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC(=N3)Cl)C4=CC=CC=C4C5=CC=CC=C5 |
Computed by PubChem (NCBI)