cas: 827-23-6 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-nitroaniline 98+% (CAS 827-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142624-1g |
| cas | 827-23-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1421.69 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142624 |
2,4-dibromo-6-nitroaniline (CAS 827-23-6) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,4-dibromo-6-nitroaniline. InChIKey: OBTUHOVIVLDLLD-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,4-dibromo-6-nitroaniline |
| InChIKey | OBTUHOVIVLDLLD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Br)Br |
Computed by PubChem (NCBI)