cas: 827-23-6 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-nitroaniline, 98% (CAS 827-23-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329828-5G |
| cas | 827-23-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 341.56 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 1294.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dibromo-6-nitroaniline (CAS 827-23-6) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,4-dibromo-6-nitroaniline. InChIKey: OBTUHOVIVLDLLD-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,4-dibromo-6-nitroaniline |
| InChIKey | OBTUHOVIVLDLLD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Br)Br |
Computed by PubChem (NCBI)