cas: 827-23-6 — see every product listed under this CAS number, including other names
2,4-Dibromo-6-nitroaniline, 98+%, 98+% (CAS 827-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FPP-1g |
| cas | 827-23-6 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 100g | 1043.60 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
2,4-dibromo-6-nitroaniline (CAS 827-23-6) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,4-dibromo-6-nitroaniline. InChIKey: OBTUHOVIVLDLLD-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,4-dibromo-6-nitroaniline |
| InChIKey | OBTUHOVIVLDLLD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Br)Br |
Computed by PubChem (NCBI)