cas: 56857-97-7 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-methylquinoline, 95+% (CAS 56857-97-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A870380-25g |
| cas | 56857-97-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 20381.20 Pln | |
| AmBeed | 5g | 7178.92 Pln | |
| AmBeed | 10g | 10902.64 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dichloro-3-methylquinoline (CAS 56857-97-7) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,4-dichloro-3-methylquinoline. InChIKey: NVZMNNRRENJIRV-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,4-dichloro-3-methylquinoline |
| InChIKey | NVZMNNRRENJIRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N=C1Cl)Cl |
Computed by PubChem (NCBI)