2,4-Dichloro-3-nitropyridine, 98%, 98%
cas: 5975-12-2 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-nitropyridine, 98%, 98% (CAS 5975-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143YZ-1g |
| cas | 5975-12-2 |
| size | 1g |
| availability | 10000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 222.80 Pln | |
| Chemat | 100g | 357.20 Pln | |
| Chemat | 1kg | 2238.80 Pln | |
| Chemat | 5kg | 10800.00 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-3-nitropyridine (CAS 5975-12-2) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,4-dichloro-3-nitropyridine. InChIKey: RTXYIHGMYDJHEU-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,4-dichloro-3-nitropyridine |
| InChIKey | RTXYIHGMYDJHEU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)