CAS 21427-62-3 appears in our catalog under these names: 2,5–dichloro–3–nitropyridine, 2,5-Dichloro-3-nitropyridine, 98%, 2,5-Dichloro-3-nitropyridine 98%, 2,5-Dichloro-3-nitropyridine, >98.0%(GC). Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 25g, 4x25g, 1g, 5g, 10g, 500g.
2,5-dichloro-3-nitropyridine (CAS 21427-62-3) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,5-dichloro-3-nitropyridine. InChIKey: OBUGJYJQJWMOQO-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,5-dichloro-3-nitropyridine |
| InChIKey | OBUGJYJQJWMOQO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)