Products 356783-15-8
CAS 356783-15-8 appears in our catalog under these names: 3,6-Dichloropyrazine-2-carboxylic acid, 95%, 3,6-Dichloropyrazine-2-carboxylic acid 95%, 3,6-Dichloropyrazine-2-carboxylic acid, 95%, 95%, 3,6-Dichloropyrazine-2-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,6-dichloropyrazine-2-carboxylic acid (CAS 356783-15-8) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,6-dichloropyrazine-2-carboxylic acid. InChIKey: JKDYBIZSSBHQLV-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,6-dichloropyrazine-2-carboxylic acid |
| InChIKey | JKDYBIZSSBHQLV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)