Products 356783-15-8

CAS 356783-15-8 appears in our catalog under these names: 3,6-Dichloropyrazine-2-carboxylic acid, 95%, 3,6-Dichloropyrazine-2-carboxylic acid, 95%, 95%, 3,6-Dichloropyrazine-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3,6-dichloropyrazine-2-carboxylic acid (CAS 356783-15-8) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,6-dichloropyrazine-2-carboxylic acid. InChIKey: JKDYBIZSSBHQLV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2N2O2
Molecular weight192.98 g/mol
IUPAC name3,6-dichloropyrazine-2-carboxylic acid
InChIKeyJKDYBIZSSBHQLV-UHFFFAOYSA-N
SMILESC1=C(N=C(C(=N1)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)