Products 433294-98-5

CAS 433294-98-5 is the registry number for 3,5-Dichloro-4-nitropyridine, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100mg.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-nitropyridine (CAS 433294-98-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloro-4-nitropyridine. InChIKey: JGZHZSXAYXXCFB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Cl2N2O2
Molecular weight192.98 g/mol
IUPAC name3,5-dichloro-4-nitropyridine
InChIKeyJGZHZSXAYXXCFB-UHFFFAOYSA-N
SMILESC1=C(C(=C(C=N1)Cl)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)