CAS 312736-49-5 appears in our catalog under these names: 3,5-Dichloropyrazine-2-carboxylic acid, 98%, 3,5-Dichloropyrazine-2-carboxylicacid, 3,5-Dichloropyrazine-2-carboxylic acid 97%, 3,5-Dichloropyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg, 500g.
3,5-dichloropyrazine-2-carboxylic acid (CAS 312736-49-5) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloropyrazine-2-carboxylic acid. InChIKey: QRFOSHOPPFYNAH-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,5-dichloropyrazine-2-carboxylic acid |
| InChIKey | QRFOSHOPPFYNAH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)