CAS 684220-30-2 appears in our catalog under these names: 4,6–Dichloropyrimidine–2–carboxylic acid, 4,6-Dichloropyrimidine-2-carboxylic acid, 95%, 4,6-Dichloropyrimidine-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g.
4,6-dichloropyrimidine-2-carboxylic acid (CAS 684220-30-2) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 4,6-dichloropyrimidine-2-carboxylic acid. InChIKey: XTPRJRYOVQDBID-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 4,6-dichloropyrimidine-2-carboxylic acid |
| InChIKey | XTPRJRYOVQDBID-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)