2,4-Dichloro-6-fluorobenzaldehyde, 95%
cas: 681435-09-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-fluorobenzaldehyde, 95% (CAS 681435-09-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QJ-2387-1g |
| cas | 681435-09-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 10g | 1260.38 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 534.80 Pln | |
| Chemat | 10g | 928.40 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 747.54 Pln | |
| BLDpharm | 10g | 1352.88 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 716.43 Pln | |
| Fluorochem | 25g | 3142.66 Pln | |
| Fluorochem | 10g | 1299.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4-dichloro-6-fluorobenzaldehyde (CAS 681435-09-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,4-dichloro-6-fluorobenzaldehyde. InChIKey: KDTLZLPZFUJFRU-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluorobenzaldehyde |
| InChIKey | KDTLZLPZFUJFRU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C=O)Cl)Cl |
Computed by PubChem (NCBI)