cas: 102878-18-2 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-methylquinoline (CAS 102878-18-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210794-250MG |
| cas | 102878-18-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 497.76 Pln |
| delivery time | 3-4 weeks |
|---|
2,4-dichloro-6-methylquinoline (CAS 102878-18-2) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,4-dichloro-6-methylquinoline. InChIKey: GLYIJJUSFYXLNF-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,4-dichloro-6-methylquinoline |
| InChIKey | GLYIJJUSFYXLNF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)