cas: 2683-43-4 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-nitroaniline 97% (CAS 2683-43-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A632902-1g |
| cas | 2683-43-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 553.94 Pln | |
| Ambeed | 100g | 1994.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A632902 |
2,4-dichloro-6-nitroaniline (CAS 2683-43-4) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,4-dichloro-6-nitroaniline. InChIKey: IZEZAMILKKYOPW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,4-dichloro-6-nitroaniline |
| InChIKey | IZEZAMILKKYOPW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Cl)Cl |
Computed by PubChem (NCBI)