cas: 1260088-72-9 — see every product listed under this CAS number, including other names
2,4-Dichloro-7,7-dimethyl-5,7-dihydrofuro[3,4-d]pyrimidine 98% (CAS 1260088-72-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A398682-50mg |
| cas | 1260088-72-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 281.38 Pln | |
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1532.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A398682 |
2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine (CAS 1260088-72-9) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine. InChIKey: IGGHWEUEJMUGHP-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine |
| InChIKey | IGGHWEUEJMUGHP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CO1)C(=NC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)