cas: 1260088-72-9 — see every product listed under this CAS number, including other names
2,4-Dichloro-7,7-dimethyl-5,7-dihydrofuro[3,4-d]pyrimidine, 97%, 97% (CAS 1260088-72-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QRF-50mg |
| cas | 1260088-72-9 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 203.60 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1235.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine (CAS 1260088-72-9) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine. InChIKey: IGGHWEUEJMUGHP-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,4-dichloro-7,7-dimethyl-5H-furo[3,4-d]pyrimidine |
| InChIKey | IGGHWEUEJMUGHP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CO1)C(=NC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)