cas: 87466-23-7 — see every product listed under this CAS number, including other names
2,4-Dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine, 95+%, 95+% (CAS 87466-23-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119CTJ-1g |
| cas | 87466-23-7 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 25g | 1672.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine (CAS 87466-23-7) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: 2,4-dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine. InChIKey: HIKOVOQFJFSCLL-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | 2,4-dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine |
| InChIKey | HIKOVOQFJFSCLL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NC(=N2)Cl)Cl)SC1 |
Computed by PubChem (NCBI)