cas: 154505-50-7 — see every product listed under this CAS number, including other names
2,4-Dichlorobenzimidamide hydrochloride, 98% (CAS 154505-50-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A486273-5g |
| cas | 154505-50-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17842.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dichlorobenzenecarboximidamide;hydrochloride (CAS 154505-50-7) is a chemical compound with the molecular formula C7H7Cl3N2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,4-dichlorobenzenecarboximidamide;hydrochloride. InChIKey: CIPUZYQYFMMYAF-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,4-dichlorobenzenecarboximidamide;hydrochloride |
| InChIKey | CIPUZYQYFMMYAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=N)N.Cl |
Computed by PubChem (NCBI)